On Target PRGR_HUMAN 0.5170068/CHEMBL197161
For the given ligand Beta M1, we have found in our database that, being scored 0.5170068, the most similar ligand is CHEMBL197161. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL197161 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CC(C)(CC(O)(Cc1ccccc1)C(=O)Nc2ccc3C(=O)OCc3c2)c4ccccc4 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014002 01000a00 40101102 80090600 240000d0 0800e000 00000000 00000000 00100900 000808d0 08380004 4001d800 04008000 00318000 00060040 020c0008 08060000 02000200 08412008 80000001 40100100 18020f20 23002040 00500014 00040c00 80002000 08080000 10000080 00428202 0006000b c0000000 00400600 |