On Target AA2AR_HUMAN 0.40782124/CHEMBL554840
For the given ligand Beta M1, we have found in our database that, being scored 0.40782124, the most similar ligand is CHEMBL554840. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL554840 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCCN(CCc1ccc(NC(=O)CCC(N)C(=O)NCCCCC(NC(=O)CCC(=O)NCCOCCOCCNC(=O)C(CCCCNC(=O)C)NC(=O)C)C(=O)N)cc1)C2CCc3c(O)cccc3C2 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00034002 43007a08 20100102 c4010600 200000a0 c0002000 02000000 20000249 00202880 000a08c0 08380004 4083b040 0600801a 0030a000 801a1048 020d2008 10040200 02000000 08002000 00020201 40100100 38240630 36006001 8b500018 00000400 80000001 00800000 100000a1 0c008202 0006c00b 20004000 00802600 |