On Target DRD4_HUMAN 0.4609375/CHEMBL589
For the given ligand Beta M1, we have found in our database that, being scored 0.4609375, the most similar ligand is CHEMBL589. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL589 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCCN(CCC)CCc1cccc2NC(=O)Cc12 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00004002 00000000 40500100 00010600 24000020 00000000 00000000 00000001 00400080 00080850 08280004 40809000 01008002 00301000 40020140 00000000 00040200 02000000 08000000 00000200 44100000 18200600 20006000 81400011 00040000 80000300 00000010 00001080 04408000 00060003 00002000 20002600 |