On Target PGH2_HUMAN 0.48818898/CHEMBL15039
For the given ligand Beta M1, we have found in our database that, being scored 0.48818898, the most similar ligand is CHEMBL15039. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL15039 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCCCC(=O)c1cc(c2N(C)CCC(C)(C)c2c1)C(C)(C)C |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00014002 01000a00 00100102 c0010600 20000001 00002040 00000000 00000000 00000800 00080ac0 08300004 40009000 04008000 00208000 00020040 080c000a 00048000 02000000 08002008 00000001 40100100 18020200 21000000 00400014 00000000 81000000 00000000 10801080 00088002 0006000a 80000080 20000600 |