On Target CXCR4_HUMAN 0.38285714/CHEMBL1644075
For the given ligand Beta M1, we have found in our database that, being scored 0.38285714, the most similar ligand is CHEMBL1644075. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL1644075 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | COCc1ccc(CN(Cc2nc3ccccc3[nH]2)C4CCCc5cccnc45)c(CN)c1 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0000001a 01004000 00104902 10850e10 00041161 00104000 01002000 22003003 00500900 000808c0 49318004 40818000 80000882 00610800 00020440 020c010c 00002200 06000006 00202408 40000201 40120100 18018020 21804000 00500010 00140000 c0002001 08004040 90000080 00400306 00c60802 60040004 20004680 |