On Target NTRK1_HUMAN 0.42288557/CHEMBL3962283
For the given ligand Beta M1, we have found in our database that, being scored 0.42288557, the most similar ligand is CHEMBL3962283. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL3962283 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CCc1ncc(cc1NC(=O)Cc2ccc(cc2)C(F)(F)F)C(=O)C3CC([C@@H](C)CO)c4ncncc34 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0001c00a 01804800 40504102 50850630 240c1120 08004052 01003410 00000001 00400900 40080850 28388024 40819800 0f008888 01b01800 40020081 120c000e 00048000 0600000c 08602408 40000005 c4100500 18348600 21c060c0 8940011d 00042002 80100301 08000550 90001080 24480006 00460003 c0122000 20c007a0 |