On Target PTGES_HUMAN 0.42771083/CHEMBL4092750
For the given ligand Beta M1, we have found in our database that, being scored 0.42771083, the most similar ligand is CHEMBL4092750. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL4092750 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | OC(=O)c1cccnc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 0002400a 01801800 00104102 10010610 20041020 0000e000 01000400 20000000 00300900 000808d0 08308004 50839800 04008802 01208000 00020060 020c000c 00040000 06000004 08202008 00000201 c0700500 18048e50 20804000 0050001c 00040000 80000201 08000240 90000080 00408006 01860003 c0120000 20802600 |