On Target MIF_HUMAN 0.24539877/CHEMBL1604170
For the given ligand Beta M1, we have found in our database that, being scored 0.24539877, the most similar ligand is CHEMBL1604170. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL1604170 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | OC(=O)c1cccc(NC(=S)NC(=O)c2ccc(cc2)c3ccccc3)c1 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00002006 00000800 00000100 40010e00 00000000 00004000 00000004 22003001 00000100 00000850 01200004 40008000 80008800 08000000 00000060 10080008 00064000 02400800 0c000000 90000a01 40040100 08038e20 30020000 00400014 00140008 80000000 00000000 a00000c0 2162c100 00060001 c0040000 88014208 |