On Target HRH1_HUMAN 0.46052632/CHEMBL328356
For the given ligand Beta M1, we have found in our database that, being scored 0.46052632, the most similar ligand is CHEMBL328356. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL328356 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | CN(C)CC1C[C@H]2[C@H](O1)c3ccccc3N(C)c4ccccc24 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00000002 01000008 00100102 80010700 000800d0 00004000 01002010 00000040 00102900 004808c0 08301004 60019000 04000000 01210000 000e1048 02081008 0804c000 02000000 0c40200a 00000001 40010120 58100030 33000040 00500110 50000c00 80002000 02080008 10001080 00008202 00261402 40000080 22000700 |