On Target NMDE1_HUMAN 0.2638889/CHEMBL284237
For the given ligand Beta M1, we have found in our database that, being scored 0.2638889, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Beta M1 (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| CNCCc2cccc3NC(CCc1ccccc1)C(OC)c23 | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00014002 01000200 40101102 00010700 200800a0 00006442 01000000 00000001 00400900 000808d0 08340004 40809800 04000000 00211000 00021160 020c000a 00840200 02000000 08402008 00000001 44100900 18200020 33004000 81400111 40040000 80002201 08000000 10001080 04408203 0006000a 40000000 20000600 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |