On Target NMDZ1_HUMAN 0.23846154/CHEMBL419399
For the given ligand drug001, we have found in our database that, being scored 0.23846154, the most similar ligand is CHEMBL419399. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL419399 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | Cc1ccc(CC2CCN(CC#Cc3ccc4[nH]c(O)nc4c3)CC2)cc1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00000202 01020810 00120902 040d0600 00442040 00004000 00000000 20100020 00100900 000808c0 09308004 50018800 00000002 00600000 60100140 000c000c 00000000 02000024 00200000 00000201 40020100 18900020 21890001 02500010 00000084 80000000 00000240 10000000 03400000 00460002 40000020 040006a0 |