On Target PDE5A_HUMAN 0.40350878/CHEMBL362755
For the given ligand drug001, we have found in our database that, being scored 0.40350878, the most similar ligand is CHEMBL362755. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL362755 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NC(C)C(=O)O |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04008009 00004808 20000109 00010600 00001081 80024000 52040000 02001200 00000100 00080a40 48200000 4000b000 02808802 00010000 01000401 0a082008 10000000 02008000 00000000 40020800 00000000 08028e20 03000000 00c0101c 00004000 c0002000 08120000 80800000 00010300 00060003 e0044004 00000600 |