On Target COMT_HUMAN 0.23134328/CHEMBL3425731
For the given ligand drug001, we have found in our database that, being scored 0.23134328, the most similar ligand is CHEMBL3425731. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3425731 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CCCCc1ccc(cc1)N2C=C(O)C(=O)C=C2CO |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00000002 01000a08 60004102 50010600 00040028 00004004 04800000 00201000 02100b00 800808c0 08100004 40018000 80008804 00600200 00020040 020c000c 00008000 02804004 00200000 00060001 40000100 18008030 20800002 81500014 02002400 c0000040 00420060 00040000 04000004 0806000a c0040000 40200400 |