On Target TRPV1_RAT 0.34234235/CHEMBL2057858
For the given ligand drug001, we have found in our database that, being scored 0.34234235, the most similar ligand is CHEMBL2057858. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL2057858 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1cc(ccc1OCCN)C(C)C(=O)NCCCc2ccc(C)c(C)c2 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000000 42001208 20100108 00210602 00001001 80000000 02040000 20000000 00000980 000808c0 08300000 40009800 0180c002 20200000 41001001 020c8008 00000000 02000000 00080000 00020201 00000100 18240600 03000000 81400018 00000000 80000000 00120000 10010000 04000200 0006000b 00002000 00002680 |