On Target FABP5_HUMAN 0.4949495/CHEMBL212860
For the given ligand drug001, we have found in our database that, being scored 0.4949495, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | OC(=O)Cc1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |