On Target MK01_HUMAN 0.38297874/CHEMBL1909070
For the given ligand drug001, we have found in our database that, being scored 0.38297874, the most similar ligand is CHEMBL1909070. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1909070 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CC(C)(Oc1ccc(cc1)C2CCCc3ccccc23)C(=O)O |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000000 01000008 2000010a 00010200 00001000 00000002 02040400 01000001 00000800 00080840 08140000 4000d000 00808002 00200000 01200001 00080008 00000200 82000000 00102000 00020001 00000100 08000a00 05004000 08400010 00000000 a0000001 00120008 40800000 02000282 00020002 00000000 00000400 |