On Target AMPN_HUMAN 0.2815534/CHEMBL3806197
For the given ligand drug001, we have found in our database that, being scored 0.2815534, the most similar ligand is CHEMBL3806197. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3806197 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1ccc(CCNCC(N)P(=O)(O)O)cc1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00000400 00000608 20100108 00010620 00001000 00000000 02040000 00000000 00000080 00080840 08200000 40008000 00000002 00020000 01000001 00000008 00000028 02000000 40000000 00020200 00000000 3d300000 00800001 83400010 00002002 80000000 00120000 00014000 0c080200 00060002 20800000 00008623 |