On Target ADRB2_HUMAN 0.47826087/CHEMBL1940816
For the given ligand drug001, we have found in our database that, being scored 0.47826087, the most similar ligand is CHEMBL1940816. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1940816 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | OCc1cc(ccc1O)C(O)CNCCc2ccc(OCC(O)c3ccccc3)cc2 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04001000 00000008 20100108 00010600 000010c1 02004000 02040000 00000840 00000180 00080840 a8200000 40008000 00800002 00000000 012c0001 00082008 18000000 02000000 04000000 40020200 00000000 18200020 07000000 89400010 00000000 80000000 00520000 00800000 04000200 00060002 40000000 00002600 |