On Target CASP1_HUMAN 0.31782946/CHEMBL115252
For the given ligand drug001, we have found in our database that, being scored 0.31782946, the most similar ligand is CHEMBL115252. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL115252 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | OC(=O)C[C@H](NS(=O)(=O)c1ccccc1OCCc2cccc3ccccc23)C=O |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04041010 00800008 21000108 01b10600 00089240 02000000 02000000 00000040 00000000 00480840 08082010 6000b000 0c808002 00000401 81240001 00082008 09006205 02400000 04c00000 00026505 80041000 18000a09 01000000 18400018 02008000 80000004 00000010 0100000c 00000602 20060002 00000000 00011468 |