On Target ACM4_HUMAN 0.42857143/CHEMBL1346
For the given ligand drug001, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL1346. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1346 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | NC(=O)C([C@@H]1CCN(CCc2ccc3OCCc3c2)C1)(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04031000 01000208 2010010a 00010600 00001041 02000010 02040000 21000240 00300880 000808c0 08300000 40039000 05808012 00200000 41040001 000c2018 08000000 02000000 04000000 00020201 00000100 18200620 01000000 81500010 00000000 a0000000 00120000 50800004 04000380 0006000a 00002000 00802600 |