On Target TNFA_HUMAN 0.26923078/CHEMBL72511
For the given ligand drug001, we have found in our database that, being scored 0.26923078, the most similar ligand is CHEMBL72511. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL72511 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccc(OC)cc1)C(C)(C)C |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00060000 00003218 60100108 04010600 00101000 00000000 0a040000 20000008 00200880 000808c0 08300000 4002b000 17008016 00002000 c1000001 00080018 00000000 02000000 00c00008 00060201 00000100 38200600 01000041 83400018 00002800 80000000 00120000 10000000 0c000202 0006000f 20006000 02802e00 |