On Target ALDR_HUMAN 0.4537037/CHEMBL312109
For the given ligand drug001, we have found in our database that, being scored 0.4537037, the most similar ligand is CHEMBL312109. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL312109 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | OC(=O)Cc1ccc2C(=O)c3ccccc3COc2c1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000000 42000808 20000108 40010200 00001041 8002c400 02000400 05020200 00000100 00080840 08000000 40009820 01808002 20210080 41040001 02082008 08000000 02008000 00080000 00020200 00000000 08020b20 01004008 02d01014 00004000 e8002200 00000800 40010000 02000381 00020002 c2002000 00000400 |