On Target P2RX3_HUMAN 0.28318584/CHEMBL3958199
For the given ligand drug001, we have found in our database that, being scored 0.28318584, the most similar ligand is CHEMBL3958199. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3958199 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CCNc1ccc(Nc2ccc(OC(C)C)cc2)c(Cc3ccc(Cl)cc3)c1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 0c00c002 00001008 60000108 00010600 00001020 00080000 02000010 01000048 00402000 00080850 08200004 40008800 02800026 00000000 01020041 00080008 00048000 02000001 08000002 00020000 44100000 08040100 20000000 00400010 00042000 a0000000 02040008 40001080 00408280 00260002 00000000 20020600 |