On Target MDR1_HUMAN 0.6625/CHEMBL272836
For the given ligand drug001, we have found in our database that, being scored 0.6625, the most similar ligand is CHEMBL272836. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL272836 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1cccc(CCc2ccccc2OCc3ccc(OC)c(OC)c3)c1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000000 4a000008 20000108 00010200 00001000 c0004000 02040000 00000200 00000900 00080848 08100000 40008040 00804002 20010000 01000005 0208a008 40000000 02008000 00080000 00020201 00000100 08100020 00000000 00c01410 00004000 c0002000 00420000 00000000 00000300 0002000a 40000000 00000500 |