On Target AGTR2_HUMAN 0.33116883/CHEMBL34124
For the given ligand drug001, we have found in our database that, being scored 0.33116883, the most similar ligand is CHEMBL34124. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL34124 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1ccc2CN([C@@H](Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04008008 46805008 20100108 10210600 000010a0 c0004000 07041000 03001204 00000980 00080840 08300000 4000b0c0 0780c882 20210080 c1080481 0208a008 90000200 02008020 00480008 00020201 80020100 18208e20 03004040 81c49418 00004800 e0002001 00224000 c0000000 04000380 0087000b 60046000 00002600 |