On Target NOS2_HUMAN 0.5050505/CHEMBL1762472
For the given ligand drug001, we have found in our database that, being scored 0.5050505, the most similar ligand is CHEMBL1762472. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1762472 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | Cl.CNCC[C@@H](Oc1cc(Cl)ccc1C#N)c2ccccc2 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04008004 00000208 20100108 00010600 00001020 02004000 d2000000 00000000 00000900 008808c0 08300000 40008800 02800006 00010002 01000003 020c2008 00600000 22008000 00800000 00020001 40000100 18000120 01000480 00c01010 00006000 80002000 00040000 10000000 00000300 0006042a 40000000 00020640 |