On Target PRGR_HUMAN 0.41379312/CHEMBL511812
For the given ligand drug001, we have found in our database that, being scored 0.41379312, the most similar ligand is CHEMBL511812. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL511812 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CC[C@@]12C[C@H](O)[C@@](O)(C[C@H]1CCc3cc(O)ccc23)c4ccccc4 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00000000 43000008 20000102 00010200 00080040 40004002 02001000 00000001 00000900 00080840 08100000 40008000 00000002 00a00000 00040020 00080008 08000200 02000000 02402000 00020201 00000100 08000020 05004040 00400010 00000000 80000001 00120000 00000000 00000002 00020002 40020000 00000400 |