On Target AA2AR_HUMAN 0.31782946/CHEMBL1795502
For the given ligand drug001, we have found in our database that, being scored 0.31782946, the most similar ligand is CHEMBL1795502. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1795502 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | Cn1cc2c3cccc(OCc4ccccc4)c3nc(N)c2n1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000006 80000408 60005108 00010620 000c1040 04004004 07000000 00600000 00000100 000008c0 00000004 40058000 00800802 08c10000 010400c1 020c000c 18040000 0200000c 01600000 00260400 40000000 1c018038 21800800 82e09000 00100400 80082000 08010280 00000800 00000208 00060000 40040000 00204520 |