On Target CXCR1_HUMAN 0.22981367/CHEMBL376621
For the given ligand drug001, we have found in our database that, being scored 0.22981367, the most similar ligand is CHEMBL376621. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL376621 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CN(C)S(=O)(=O)c1c(Cl)ccc(N\C(=N\C#N)\Nc2ccccc2OCc3ccccc3)c1O |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04008016 00800018 21000108 00b10a40 80001200 00024000 12000000 01002001 00040100 00004842 10242004 60008840 02804006 0001000b 81200151 0208c208 00842a00 0a000000 08400000 00026300 d0020102 08002120 20420400 08c31008 0090a800 80082000 60080808 0000008c 00008690 20060004 40000000 06034068 |