On Target PGH2_HUMAN 0.58441556/CHEMBL1958349
For the given ligand drug001, we have found in our database that, being scored 0.58441556, the most similar ligand is CHEMBL1958349. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL1958349 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CC(C)Cc1ccc(cc1)C(C)C(=O)Oc2ccc(CCO)cc2 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04001000 00000008 20000108 00010200 00001040 02000000 02040000 00000040 00000900 00080840 08100000 40009800 01808002 00000000 41050001 00082008 08020000 02000000 04000000 00020001 00000100 08000a00 11000000 00400010 00000000 80000000 00120000 00000000 00000200 00020002 00002000 10000400 |