On Target TLR4_HUMAN 0.3/CHEMBL3261034
For the given ligand drug001, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3261034. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3261034 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1ccc(cc1OC)[C@@H]2[C@@H](C3CCCC3)[C@H]4[C@@H]2C5=C(OC4(C)C)c6ccccc6NC5=O |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000002 43006018 2800410a 00810710 000c1102 c2000060 02042000 00000208 06400800 40080860 0c100004 40008040 0080c802 20e00810 11100041 000ca40c 40800000 22008004 00682400 00060201 40000100 08108008 21800040 88500410 00040001 c0000000 08120080 00000040 10400302 1506400a 00060000 00200500 |