On Target OPRD_HUMAN 0.47572815/CHEMBL431156
For the given ligand drug001, we have found in our database that, being scored 0.47572815, the most similar ligand is CHEMBL431156. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL431156 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CCC1Oc2c(O)cccc2C13CCN(C)CC3 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04001000 43000208 2010010a 00210700 00101041 c2000000 02000000 20000240 00000800 000808c0 08300000 50018040 00804002 00200000 11040001 000ca018 08000000 22008000 04402000 00020201 00000100 18000010 01000000 00500410 00000000 c0000000 00000200 10000000 00000300 0006c00a 00000000 00000e40 |