On Target CNR2_HUMAN 0.47191012/CHEMBL3963126
For the given ligand drug001, we have found in our database that, being scored 0.47191012, the most similar ligand is CHEMBL3963126. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3963126 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | CCCCCCC(C)(C)c1cc(OC)c(C2C(O)[C@]3(C)CC[C@H]2C3(C)C)c(OC)c1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00000001 43000008 2000010a 00010200 00081040 40000000 42000000 00008200 00000900 00080840 08100000 40008940 00000002 20a00000 01040001 00082008 08000000 02000004 02482000 00020a01 00000100 08000000 01000000 00400410 00000000 c0000000 00000000 00000000 00000302 01024002 00020000 00000400 |