On Target 5HT2C_HUMAN 0.625/CHEMBL2022192
For the given ligand drug001, we have found in our database that, being scored 0.625, the most similar ligand is CHEMBL2022192. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL2022192 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | Cl.NC[C@H]1C[C@@H]1c2ccccc2OCc3ccccc3 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04000000 01000208 2000010a 00010600 00001000 80004000 02000000 00000200 00100900 000808c0 08100000 40018040 00800002 01210000 01000001 02082008 00000000 02008000 00000000 00020001 00000100 18000020 00000000 00c01410 00004000 c0002000 00000000 00000000 00000300 0006c00a 40000000 00020400 |