On Target PTGES_HUMAN 0.6813187/CHEMBL3754065
For the given ligand drug001, we have found in our database that, being scored 0.6813187, the most similar ligand is CHEMBL3754065. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3754065 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | COc1ccc(\C=C\c2ccc3O[C@H]([C@H](c4ccc(OC)cc4)c3c2)c5ccc(O)cc5)cc1 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 04001000 00000008 20000108 00010200 00001041 82004000 82040080 01000640 00000900 00080840 08100100 40008240 00800002 00010000 01040003 02082018 48000400 02008000 04000000 00020001 00000100 18100020 01000001 02c01010 00004000 e0002000 00522008 40000004 00404380 00220002 46000000 00000500 |