On Target IKKB_HUMAN 0.36734694/CHEMBL3318321
For the given ligand drug001, we have found in our database that, being scored 0.36734694, the most similar ligand is CHEMBL3318321. Check out the elaboration below.
| drug001 (Given Ligand) | CHEMBL3318321 (Similar Ligand) |
|---|---|
| c3ccc(C2Cc1ccccc1O2)cc3 | O[C@H]1CCC(=O)c2c(O)cccc12 |
|
|
|
|
|
|
| 04001000 00000008 20000108 00010200 00001040 02004000 02000000 00000240 00000900 00080840 08100000 40008040 00800002 00010000 01040001 02082018 48000000 02008000 04000000 00020001 00000100 08100020 01000000 00c01010 00004000 80002000 00000000 00000000 00000300 00020002 40000000 00000500 | 00050000 4b000808 20000102 00010200 00080000 4002c000 02000000 00000201 00000900 00080840 08100000 40009840 04008002 00200000 00000000 00082008 00000200 02000000 00402000 00020201 00400500 08020360 01004000 00400014 00000000 80000201 00000000 00000000 00000002 00024002 c0000000 00400400 |