On Target PERM_HUMAN 0.39455783/CHEMBL1409565
For the given ligand D3263, we have found in our database that, being scored 0.39455783, the most similar ligand is CHEMBL1409565. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1409565 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | O=C1N(CCN2CCCCC2)C(=S)Nc3ccccc13 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00040002 01000400 00100000 40000600 001c0000 00004020 02000000 20000800 06200101 400c08e0 0120100c 50018000 00009002 00e00000 000008c0 000c0004 40000000 01008100 00600020 01010201 c0000000 38000038 21800041 02300010 0c000000 80000000 20000000 10040000 08004000 00470010 40080000 00010a88 |