On Target ACES_HUMAN 0.45962733/CHEMBL1773485
For the given ligand D3263, we have found in our database that, being scored 0.45962733, the most similar ligand is CHEMBL1773485. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1773485 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CN(Cc1ccccc1)Cc2ccc(cc2)C(=O)c3ccc(OCCCN4CCC(CC4)N5C(=O)Nc6ccccc56)cc3 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 01000c08 20100109 40010600 000c1040 02004080 02040000 23001000 04200100 800809e0 0d20800c 50018800 80809802 01c40000 013004c1 000c200c 00302000 02000000 00e00000 00020201 c0000000 18028230 21800081 00700014 00000001 e0000000 00120000 d0000000 00000380 00460012 c00c0000 000026c0 |