On Target COMT_HUMAN 0.32692307/CHEMBL3980370
For the given ligand D3263, we have found in our database that, being scored 0.32692307, the most similar ligand is CHEMBL3980370. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3980370 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | COc1ccc(Oc2cccc(c2)C3=NC=C(O)C(=O)N3C)cc1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00004002 40000008 60000108 10810600 00081028 00004004 02801800 00480000 06000100 100008e0 0000000c 40008000 00009002 00400001 01020081 000c000c 000000a0 0200a000 00482000 00462200 00500000 18000000 a1800041 00700000 00000802 c0000200 20080000 00240000 00004284 00460400 40000c00 42000080 |