On Target TRPV1_RAT 0.3236994/CHEMBL436839
For the given ligand D3263, we have found in our database that, being scored 0.3236994, the most similar ligand is CHEMBL436839. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL436839 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CC(C)c1cc2N=C(C)NC(=O)c2cc1c3ccc(Cl)c(OCC4CC4)c3 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 0400a002 40000809 20000108 50450700 00041020 02004020 02001800 00000000 06000100 40080860 09000004 40008800 02818006 01608080 31020041 020c200c 00020040 02008004 04e80000 00221203 40000000 08000128 31804040 00500010 00802000 80008800 20040040 00040040 00404204 00420002 40401000 410204a0 |