On Target HYES_HUMAN 0.4/CHEMBL397694
For the given ligand D3263, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL397694. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL397694 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | [O-][N+](=O)c1ccc(O[C@@H]2CC[C@H](CC2)NC(=O)NC34CC5CC(CC(C5)C3)C4)cc1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 01001018 20100008 00010f00 00181000 02000000 02000004 00002008 14000000 000008e0 04200004 40018000 00819002 00800000 31100141 00082018 00800000 00000000 02402040 00020001 40020100 18050410 21000000 00100018 00010000 40000000 00040200 10000040 04000200 00060001 000a0000 04000a00 |