On Target AOFA_HUMAN 0.36956522/CHEMBL1645548
For the given ligand D3263, we have found in our database that, being scored 0.36956522, the most similar ligand is CHEMBL1645548. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1645548 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | Cc1nccc2c3ccc(OCC4CCCCC4)cc3[nH]c12 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 01000008 20004108 10010710 000c1060 02000000 06008000 00000008 00000000 00000840 00000004 40008000 00800802 00c00000 11060041 020c200c 08800000 02000004 02602000 00060001 40000000 08008008 21800000 80400010 00040000 80000000 08008040 00000000 00000204 00060000 00060200 00200400 |