On Target CHLE_HUMAN 0.43356642/CHEMBL452339
For the given ligand D3263, we have found in our database that, being scored 0.43356642, the most similar ligand is CHEMBL452339. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL452339 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CCN(CCCCCCN1C(=O)C(=O)N(CCCCCCN(CC)Cc2ccccc2OC)c3ccccc13)Cc4ccccc4OC |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00000022 01008008 20100108 00010700 000c1040 00000140 02008006 22001400 06000000 801008e0 0c200004 40018000 00008802 00c00000 01b404c1 0004200c 08800000 02000000 00602000 00020201 c0000080 18008010 21800000 00700010 00000000 c0000000 00008000 90000000 00000300 00060000 240c0000 00000200 |