On Target DRD2_HUMAN 0.51111114/CHEMBL2059304
For the given ligand D3263, we have found in our database that, being scored 0.51111114, the most similar ligand is CHEMBL2059304. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL2059304 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | O=C1Nc2ccccc2N1C3CCN(CCOc4ccccc4)CC3 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04002002 01000408 20100008 00000602 000c10c0 00004080 02000000 20000000 04200100 800009e0 0d20800c 50018000 00809002 01c40000 013810c1 000c000c 10100000 00000000 00600000 00020201 c0000000 18040030 33800001 00300010 00000000 40000000 00000000 10000001 00000200 00460010 40080000 00000280 |