On Target NEP_HUMAN 0.36196318/CHEMBL213944
For the given ligand D3263, we have found in our database that, being scored 0.36196318, the most similar ligand is CHEMBL213944. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL213944 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CCCC(CC1(CCCC1)C(=O)NC2=CN(Cc3ccccc3)C(=O)C=C2)C(=O)O |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 00014002 01800200 00104100 00010620 200c0000 08002050 00000000 00001000 06100000 400208e0 0428000c 40019000 04028838 01f00000 00120081 000c000c 00040000 02004008 08602000 00000005 c0100001 18008e10 2180e000 81700810 00000002 c0100000 00000410 10040080 04000000 01460009 00060000 00000288 |