On Target NOS1_HUMAN 0.3432836/CHEMBL3217000
For the given ligand D3263, we have found in our database that, being scored 0.3432836, the most similar ligand is CHEMBL3217000. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL3217000 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | Cl.Cl.CCOc1ccc(Cc2nc3cc(NC(=N)c4cccs4)ccc3n2CCN(C)C)cc1 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 0401400a 00800018 22100508 50090600 001c1060 00084000 02048080 02001200 10200100 100818c3 0920920c 4081c080 00881812 01400020 01022cc1 020c008c 0004d000 03000009 08600000 0002020c c0121000 780480b0 21810001 00400410 0a000000 c4000002 40120080 80000084 0804831c 00460812 62080000 24c30ec0 |