On Target AOFB_HUMAN 0.44067797/CHEMBL2312975
For the given ligand D3263, we have found in our database that, being scored 0.44067797, the most similar ligand is CHEMBL2312975. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL2312975 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CN1C(=O)N(C)c2cc(OCc3ccc(Cl)cc3)n(C)c2C1=O |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 0400802a 02800018 60400108 02010700 800c1040 0000c140 04088002 00008008 06400300 c00008e0 0d04000c c0018800 02809886 00e10000 613c02c1 021c000c 18808000 02808008 00600000 00860000 c00200c0 18008170 21800041 00f01000 00042040 c0002000 60048008 00040040 00004200 00460000 40080200 04220282 |