On Target GRM5_HUMAN 0.3935484/CHEMBL1682808
For the given ligand D3263, we have found in our database that, being scored 0.3935484, the most similar ligand is CHEMBL1682808. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL1682808 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | Cn1cnc2cc(OC(=O)c3ccccc3)cnc12 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 04000002 00000808 60084108 00010600 000c1040 0400c004 04088000 00600008 00400100 000008c0 0000800c 40058000 00809804 08810000 010f0044 020c000c 08020000 02002008 00600000 00060000 c0000000 18028a30 31800001 00c09004 00002c00 80082200 00008200 00000000 00000200 00460000 c0000000 30200480 |