On Target PRGR_HUMAN 0.44217688/CHEMBL188228
For the given ligand D3263, we have found in our database that, being scored 0.44217688, the most similar ligand is CHEMBL188228. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL188228 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CCCCCN1C(=O)Nc2ccc(cc12)c3ccc(F)c(Cl)c3 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 0000a002 01000800 00100100 02850600 008c0040 00006050 04000000 00000000 04000100 800008e0 0d00800c 60018800 02009004 00c01000 803000c0 000c0004 00020000 02800004 04600000 00102003 c0000000 18020130 31800001 00700018 00002000 c0001000 00000040 00000051 00404000 00468000 40080000 000202a0 |