On Target PGH2_HUMAN 0.35263157/CHEMBL97411
For the given ligand D3263, we have found in our database that, being scored 0.35263157, the most similar ligand is CHEMBL97411. Check out the elaboration below.
| D3263 (Given Ligand) | CHEMBL97411 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)n(CCN)c(=O)n2C(=O)[C@@H]3C[C@H](C)CCC3C(C)C | CCCCCCCCOC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c3ccc(OC)cc13 |
|
|
|
|
|
|
| 00010002 01000008 20000188 40010700 001c1040 00004040 06080000 00000008 04000101 800008f0 0d00900c 40019000 0400900e 01c00000 013008c1 000c100c 00830000 00000008 02602000 00060001 c0000000 38000630 21800001 00200010 18002040 40000000 00000000 00000040 00000200 00460003 400a0000 00200080 | 0000804a 01000a08 20100188 50010718 000c5060 00000000 060c2000 00001040 80500000 000838c0 08000004 4001b800 03008866 00e08000 c10e0041 020c100c 18830000 83800004 05682400 00020201 40010020 18028f18 21804000 81500014 00042400 c0000100 08160000 10000000 04000204 0006084b 80062200 00020420 |